C10H16N4OS — CID 105072201
3-hydrazinyl-N-(3-methylsulfanylpropyl)pyridine-4-carboxamide (PubChem CID 105072201) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 3-hydrazinyl-N-(3-methylsulfanylpropyl)pyridine-4-carboxamide.
| Compound Name | 3-hydrazinyl-N-(3-methylsulfanylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105072201 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 3-hydrazinyl-N-(3-methylsulfanylpropyl)pyridine-4-carboxamide |
| SMILES | CSCCCNC(=O)c1ccncc1NN |
| InChI | InChI=1S/C10H16N4OS/c1-16-6-2-4-13-10(15)8-3-5-12-7-9(8)14-11/h3,5,7,14H,2,4,6,11H2,1H3,(H,13,15) |
| InChIKey | LFOYAAADCYWIIQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|