C10H13F3N4O — CID 105072384
3-hydrazinyl-N-(4,4,4-trifluorobutyl)pyridine-4-carboxamide (PubChem CID 105072384) has the molecular formula C10H13F3N4O and a molecular weight of 262.23 g/mol. Its IUPAC name is 3-hydrazinyl-N-(4,4,4-trifluorobutyl)pyridine-4-carboxamide.
| Compound Name | 3-hydrazinyl-N-(4,4,4-trifluorobutyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105072384 |
| Molecular Formula | C10H13F3N4O |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-hydrazinyl-N-(4,4,4-trifluorobutyl)pyridine-4-carboxamide |
| SMILES | NNc1cnccc1C(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C10H13F3N4O/c11-10(12,13)3-1-4-16-9(18)7-2-5-15-6-8(7)17-14/h2,5-6,17H,1,3-4,14H2,(H,16,18) |
| InChIKey | UXXPLLLASZITII-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|