C13H18F4N2O — CID 105075003
2-methyl-N-[[3-(2,2,3,3-tetrafluoropropoxy)-4-pyridinyl]methyl]propan-2-amine (PubChem CID 105075003) has the molecular formula C13H18F4N2O and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-methyl-N-[[3-(2,2,3,3-tetrafluoropropoxy)-4-pyridinyl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[3-(2,2,3,3-tetrafluoropropoxy)-4-pyridinyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 105075003 |
| Molecular Formula | C13H18F4N2O |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-methyl-N-[[3-(2,2,3,3-tetrafluoropropoxy)-4-pyridinyl]methyl]propan-2-amine |
| SMILES | CC(C)(C)NCc1ccncc1OCC(F)(F)C(F)F |
| InChI | InChI=1S/C13H18F4N2O/c1-12(2,3)19-6-9-4-5-18-7-10(9)20-8-13(16,17)11(14)15/h4-5,7,11,19H,6,8H2,1-3H3 |
| InChIKey | SWUQESJQMDEXME-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|