C17H22N2OS — CID 105075661
2-methyl-N-[[3-(4-methylsulfanylphenoxy)-4-pyridinyl]methyl]propan-2-amine (PubChem CID 105075661) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-methyl-N-[[3-(4-methylsulfanylphenoxy)-4-pyridinyl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[3-(4-methylsulfanylphenoxy)-4-pyridinyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 105075661 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-methyl-N-[[3-(4-methylsulfanylphenoxy)-4-pyridinyl]methyl]propan-2-amine |
| SMILES | CSc1ccc(Oc2cnccc2CNC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H22N2OS/c1-17(2,3)19-11-13-9-10-18-12-16(13)20-14-5-7-15(21-4)8-6-14/h5-10,12,19H,11H2,1-4H3 |
| InChIKey | KJZJJBQSOIUSFM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |