C12H14BrNO — CID 105077750
1-(2-bromo-5-methoxyphenyl)-N-methylbut-3-yn-1-amine (PubChem CID 105077750) has the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. Its IUPAC name is 1-(2-bromo-5-methoxyphenyl)-N-methylbut-3-yn-1-amine.
| Compound Name | 1-(2-bromo-5-methoxyphenyl)-N-methylbut-3-yn-1-amine |
|---|---|
| PubChem CID | 105077750 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 1-(2-bromo-5-methoxyphenyl)-N-methylbut-3-yn-1-amine |
| SMILES | C#CCC(NC)c1cc(OC)ccc1Br |
| InChI | InChI=1S/C12H14BrNO/c1-4-5-12(14-2)10-8-9(15-3)6-7-11(10)13/h1,6-8,12,14H,5H2,2-3H3 |
| InChIKey | KLVGLDSZRCIDHC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|