C13H11FN2O — CID 105078698
(3,6-dimethylpyridazin-4-yl)-(4-fluorophenyl)methanone (PubChem CID 105078698) has the molecular formula C13H11FN2O and a molecular weight of 230.24 g/mol. Its IUPAC name is (3,6-dimethylpyridazin-4-yl)-(4-fluorophenyl)methanone.
| Compound Name | (3,6-dimethylpyridazin-4-yl)-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 105078698 |
| Molecular Formula | C13H11FN2O |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (3,6-dimethylpyridazin-4-yl)-(4-fluorophenyl)methanone |
| SMILES | Cc1cc(C(=O)c2ccc(F)cc2)c(C)nn1 |
| InChI | InChI=1S/C13H11FN2O/c1-8-7-12(9(2)16-15-8)13(17)10-3-5-11(14)6-4-10/h3-7H,1-2H3 |
| InChIKey | XVSRVUATNWVHKE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |