C18H17BrO2 — CID 105079611
1-(7-bromo-1-benzofuran-2-yl)-2-(3,5-dimethylphenyl)ethanol (PubChem CID 105079611) has the molecular formula C18H17BrO2 and a molecular weight of 345.24 g/mol. Its IUPAC name is 1-(7-bromo-1-benzofuran-2-yl)-2-(3,5-dimethylphenyl)ethanol.
| Compound Name | 1-(7-bromo-1-benzofuran-2-yl)-2-(3,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 105079611 |
| Molecular Formula | C18H17BrO2 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 1-(7-bromo-1-benzofuran-2-yl)-2-(3,5-dimethylphenyl)ethanol |
| SMILES | Cc1cc(C)cc(CC(O)c2cc3cccc(Br)c3o2)c1 |
| InChI | InChI=1S/C18H17BrO2/c1-11-6-12(2)8-13(7-11)9-16(20)17-10-14-4-3-5-15(19)18(14)21-17/h3-8,10,16,20H,9H2,1-2H3 |
| InChIKey | PAGXSTZUNDDUGI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |