C13H11BrO2 — CID 105098554
1-(7-bromo-1-benzofuran-2-yl)pent-4-yn-1-ol (PubChem CID 105098554) has the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. Its IUPAC name is 1-(7-bromo-1-benzofuran-2-yl)pent-4-yn-1-ol.
| Compound Name | 1-(7-bromo-1-benzofuran-2-yl)pent-4-yn-1-ol |
|---|---|
| PubChem CID | 105098554 |
| Molecular Formula | C13H11BrO2 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 1-(7-bromo-1-benzofuran-2-yl)pent-4-yn-1-ol |
| SMILES | C#CCCC(O)c1cc2cccc(Br)c2o1 |
| InChI | InChI=1S/C13H11BrO2/c1-2-3-7-11(15)12-8-9-5-4-6-10(14)13(9)16-12/h1,4-6,8,11,15H,3,7H2 |
| InChIKey | BQOPCMBPNAKXPK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|