C17H24O2 — CID 105082812
4-propoxy-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-one (PubChem CID 105082812) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-propoxy-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-one.
| Compound Name | 4-propoxy-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-one |
|---|---|
| PubChem CID | 105082812 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 4-propoxy-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-one |
| SMILES | CCCOCCC(=O)CC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H24O2/c1-2-11-19-12-10-16(18)13-15-8-5-7-14-6-3-4-9-17(14)15/h3-4,6,9,15H,2,5,7-8,10-13H2,1H3 |
| InChIKey | ZKWZMWABJFEXFK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|