C16H22O3 — CID 114984029
1-(3,4-dihydro-1H-isochromen-1-yl)-4-propoxybutan-2-one (PubChem CID 114984029) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isochromen-1-yl)-4-propoxybutan-2-one.
| Compound Name | 1-(3,4-dihydro-1H-isochromen-1-yl)-4-propoxybutan-2-one |
|---|---|
| PubChem CID | 114984029 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 1-(3,4-dihydro-1H-isochromen-1-yl)-4-propoxybutan-2-one |
| SMILES | CCCOCCC(=O)CC1OCCc2ccccc21 |
| InChI | InChI=1S/C16H22O3/c1-2-9-18-10-8-14(17)12-16-15-6-4-3-5-13(15)7-11-19-16/h3-6,16H,2,7-12H2,1H3 |
| InChIKey | MIXYSKIDKKRXGM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|