About N,3-dimethyl-1-(1,2,5-thiadiazol-3-yl)butan-1-amine
N,3-dimethyl-1-(1,2,5-thiadiazol-3-yl)butan-1-amine (PubChem CID 105082987) has the molecular formula C8H15N3S
and a molecular weight of 185.30 g/mol. Its IUPAC name is N,3-dimethyl-1-(1,2,5-thiadiazol-3-yl)butan-1-amine.
Analyze N,3-dimethyl-1-(1,2,5-thiadiazol-3-yl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethyl-1-(1,2,5-thiadiazol-3-yl)butan-1-amine?
The IUPAC name of N,3-dimethyl-1-(1,2,5-thiadiazol-3-yl)butan-1-amine (CID 105082987) is N,3-dimethyl-1-(1,2,5-thiadiazol-3-yl)butan-1-amine.
What is the SMILES notation for N,3-dimethyl-1-(1,2,5-thiadiazol-3-yl)butan-1-amine?
The canonical SMILES for N,3-dimethyl-1-(1,2,5-thiadiazol-3-yl)butan-1-amine is CNC(CC(C)C)c1cnsn1.
What is the InChIKey of N,3-dimethyl-1-(1,2,5-thiadiazol-3-yl)butan-1-amine?
The InChIKey is OIFTXNPTIZQUKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3S/c1-6(2)4-7(9-3)8-5-10-12-11-8/h5-7,9H,4H2,1-3H3.
What are the key properties of N,3-dimethyl-1-(1,2,5-thiadiazol-3-yl)butan-1-amine?
N,3-dimethyl-1-(1,2,5-thiadiazol-3-yl)butan-1-amine has a molecular weight of 185.30 g/mol, XLogP of 1.84, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethyl-1-(1,2,5-thiadiazol-3-yl)butan-1-amine is sourced from PubChem (CID 105082987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).