C9H15N3S — CID 105163885
N-methyl-3-methylidene-1-(1,2,5-thiadiazol-3-yl)pentan-1-amine (PubChem CID 105163885) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is N-methyl-3-methylidene-1-(1,2,5-thiadiazol-3-yl)pentan-1-amine.
| Compound Name | N-methyl-3-methylidene-1-(1,2,5-thiadiazol-3-yl)pentan-1-amine |
|---|---|
| PubChem CID | 105163885 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | N-methyl-3-methylidene-1-(1,2,5-thiadiazol-3-yl)pentan-1-amine |
| SMILES | C=C(CC)CC(NC)c1cnsn1 |
| InChI | InChI=1S/C9H15N3S/c1-4-7(2)5-8(10-3)9-6-11-13-12-9/h6,8,10H,2,4-5H2,1,3H3 |
| InChIKey | GBNJQOQXIHOKOT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|