C10H8F2N2OS — CID 105083463
2-(2,4-difluorophenyl)-1-(thiadiazol-4-yl)ethanol (PubChem CID 105083463) has the molecular formula C10H8F2N2OS and a molecular weight of 242.25 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-(thiadiazol-4-yl)ethanol.
| Compound Name | 2-(2,4-difluorophenyl)-1-(thiadiazol-4-yl)ethanol |
|---|---|
| PubChem CID | 105083463 |
| Molecular Formula | C10H8F2N2OS |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-(thiadiazol-4-yl)ethanol |
| SMILES | OC(Cc1ccc(F)cc1F)c1csnn1 |
| InChI | InChI=1S/C10H8F2N2OS/c11-7-2-1-6(8(12)4-7)3-10(15)9-5-16-14-13-9/h1-2,4-5,10,15H,3H2 |
| InChIKey | JXKPYHRRIIGAEG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |