C10H8ClFN2OS — CID 103043682
2-(3-chloro-4-fluorophenyl)-1-(thiadiazol-4-yl)ethanol (PubChem CID 103043682) has the molecular formula C10H8ClFN2OS and a molecular weight of 258.71 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-1-(thiadiazol-4-yl)ethanol.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-1-(thiadiazol-4-yl)ethanol |
|---|---|
| PubChem CID | 103043682 |
| Molecular Formula | C10H8ClFN2OS |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-1-(thiadiazol-4-yl)ethanol |
| SMILES | OC(Cc1ccc(F)c(Cl)c1)c1csnn1 |
| InChI | InChI=1S/C10H8ClFN2OS/c11-7-3-6(1-2-8(7)12)4-10(15)9-5-16-14-13-9/h1-3,5,10,15H,4H2 |
| InChIKey | HLIMNAOTATXWRP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |