C16H30N2O — CID 105084964
1-(1,3,5-trimethylpyrazol-4-yl)decan-1-ol (PubChem CID 105084964) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-(1,3,5-trimethylpyrazol-4-yl)decan-1-ol.
| Compound Name | 1-(1,3,5-trimethylpyrazol-4-yl)decan-1-ol |
|---|---|
| PubChem CID | 105084964 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 1-(1,3,5-trimethylpyrazol-4-yl)decan-1-ol |
| SMILES | CCCCCCCCCC(O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C16H30N2O/c1-5-6-7-8-9-10-11-12-15(19)16-13(2)17-18(4)14(16)3/h15,19H,5-12H2,1-4H3 |
| InChIKey | OBGMXMQCOAZFFD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|