C11H18N2O — CID 105102312
1-(1,3,5-trimethylpyrazol-4-yl)pent-4-en-1-ol (PubChem CID 105102312) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(1,3,5-trimethylpyrazol-4-yl)pent-4-en-1-ol.
| Compound Name | 1-(1,3,5-trimethylpyrazol-4-yl)pent-4-en-1-ol |
|---|---|
| PubChem CID | 105102312 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-(1,3,5-trimethylpyrazol-4-yl)pent-4-en-1-ol |
| SMILES | C=CCCC(O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C11H18N2O/c1-5-6-7-10(14)11-8(2)12-13(4)9(11)3/h5,10,14H,1,6-7H2,2-4H3 |
| InChIKey | YGOGWQOZPJPIHN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|