About cyclopropyl-(1,3,5-trimethylpyrazol-4-yl)methanol
cyclopropyl-(1,3,5-trimethylpyrazol-4-yl)methanol (PubChem CID 105105459) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is cyclopropyl-(1,3,5-trimethylpyrazol-4-yl)methanol.
Molecular Properties
| Compound Name | cyclopropyl-(1,3,5-trimethylpyrazol-4-yl)methanol |
| PubChem CID | 105105459 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | cyclopropyl-(1,3,5-trimethylpyrazol-4-yl)methanol |
| SMILES | Cc1nn(C)c(C)c1C(O)C1CC1 |
| InChI | InChI=1S/C10H16N2O/c1-6-9(7(2)12(3)11-6)10(13)8-4-5-8/h8,10,13H,4-5H2,1-3H3 |
| InChIKey | NDPXTLLDOHJZKC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopropyl-(1,3,5-trimethylpyrazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-(1,3,5-trimethylpyrazol-4-yl)methanol?
The IUPAC name of cyclopropyl-(1,3,5-trimethylpyrazol-4-yl)methanol (CID 105105459) is cyclopropyl-(1,3,5-trimethylpyrazol-4-yl)methanol.
What is the SMILES notation for cyclopropyl-(1,3,5-trimethylpyrazol-4-yl)methanol?
The canonical SMILES for cyclopropyl-(1,3,5-trimethylpyrazol-4-yl)methanol is Cc1nn(C)c(C)c1C(O)C1CC1.
What is the InChIKey of cyclopropyl-(1,3,5-trimethylpyrazol-4-yl)methanol?
The InChIKey is NDPXTLLDOHJZKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-6-9(7(2)12(3)11-6)10(13)8-4-5-8/h8,10,13H,4-5H2,1-3H3.
What are the key properties of cyclopropyl-(1,3,5-trimethylpyrazol-4-yl)methanol?
cyclopropyl-(1,3,5-trimethylpyrazol-4-yl)methanol has a molecular weight of 180.25 g/mol, XLogP of 1.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-(1,3,5-trimethylpyrazol-4-yl)methanol is sourced from PubChem (CID 105105459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).