C16H18O3 — CID 105085257
4-(furan-2-yl)-1-(2-methoxy-5-methylphenyl)butan-2-one (PubChem CID 105085257) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-(furan-2-yl)-1-(2-methoxy-5-methylphenyl)butan-2-one.
| Compound Name | 4-(furan-2-yl)-1-(2-methoxy-5-methylphenyl)butan-2-one |
|---|---|
| PubChem CID | 105085257 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 4-(furan-2-yl)-1-(2-methoxy-5-methylphenyl)butan-2-one |
| SMILES | COc1ccc(C)cc1CC(=O)CCc1ccco1 |
| InChI | InChI=1S/C16H18O3/c1-12-5-8-16(18-2)13(10-12)11-14(17)6-7-15-4-3-9-19-15/h3-5,8-10H,6-7,11H2,1-2H3 |
| InChIKey | PKYLYSJBJYZWQH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |