C16H22ClN3S — CID 105085999
N-[2-(3-chlorophenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethyl]propan-1-amine (PubChem CID 105085999) has the molecular formula C16H22ClN3S and a molecular weight of 323.89 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(3-chlorophenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105085999 |
| Molecular Formula | C16H22ClN3S |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-[2-(3-chlorophenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cccc(Cl)c1)c1snnc1C(C)C |
| InChI | InChI=1S/C16H22ClN3S/c1-4-8-18-14(10-12-6-5-7-13(17)9-12)16-15(11(2)3)19-20-21-16/h5-7,9,11,14,18H,4,8,10H2,1-3H3 |
| InChIKey | ZUITUZHUOYCXJQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |