C14H17ClFN3S — CID 103043275
2-(3-chloro-4-fluorophenyl)-N-methyl-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine (PubChem CID 103043275) has the molecular formula C14H17ClFN3S and a molecular weight of 313.83 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-N-methyl-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-N-methyl-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 103043275 |
| Molecular Formula | C14H17ClFN3S |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-N-methyl-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine |
| SMILES | CNC(Cc1ccc(F)c(Cl)c1)c1snnc1C(C)C |
| InChI | InChI=1S/C14H17ClFN3S/c1-8(2)13-14(20-19-18-13)12(17-3)7-9-4-5-11(16)10(15)6-9/h4-6,8,12,17H,7H2,1-3H3 |
| InChIKey | STBAOYYFXBAOMG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |