C15H20FN3S — CID 105377327
2-(5-fluoro-2-methylphenyl)-N-methyl-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine (PubChem CID 105377327) has the molecular formula C15H20FN3S and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-(5-fluoro-2-methylphenyl)-N-methyl-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine.
| Compound Name | 2-(5-fluoro-2-methylphenyl)-N-methyl-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 105377327 |
| Molecular Formula | C15H20FN3S |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-(5-fluoro-2-methylphenyl)-N-methyl-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine |
| SMILES | CNC(Cc1cc(F)ccc1C)c1snnc1C(C)C |
| InChI | InChI=1S/C15H20FN3S/c1-9(2)14-15(20-19-18-14)13(17-4)8-11-7-12(16)6-5-10(11)3/h5-7,9,13,17H,8H2,1-4H3 |
| InChIKey | SWLIVWPUDRPPBC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |