C13H15ClFN3S — CID 102622687
2-(2-chloro-5-fluorophenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine (PubChem CID 102622687) has the molecular formula C13H15ClFN3S and a molecular weight of 299.80 g/mol. Its IUPAC name is 2-(2-chloro-5-fluorophenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine.
| Compound Name | 2-(2-chloro-5-fluorophenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 102622687 |
| Molecular Formula | C13H15ClFN3S |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-(2-chloro-5-fluorophenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine |
| SMILES | CC(C)c1nnsc1C(N)Cc1cc(F)ccc1Cl |
| InChI | InChI=1S/C13H15ClFN3S/c1-7(2)12-13(19-18-17-12)11(16)6-8-5-9(15)3-4-10(8)14/h3-5,7,11H,6,16H2,1-2H3 |
| InChIKey | PIDDAPOHVCGKDL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |