C14H18ClN3OS — CID 105137302
2-(5-chloro-2-methoxyphenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine (PubChem CID 105137302) has the molecular formula C14H18ClN3OS and a molecular weight of 311.84 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 105137302 |
| Molecular Formula | C14H18ClN3OS |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine |
| SMILES | COc1ccc(Cl)cc1CC(N)c1snnc1C(C)C |
| InChI | InChI=1S/C14H18ClN3OS/c1-8(2)13-14(20-18-17-13)11(16)7-9-6-10(15)4-5-12(9)19-3/h4-6,8,11H,7,16H2,1-3H3 |
| InChIKey | BWSCXWUIUCCZDO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |