C11H12ClN3OS — CID 105137300
2-(5-chloro-2-methoxyphenyl)-1-(thiadiazol-4-yl)ethanamine (PubChem CID 105137300) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-1-(thiadiazol-4-yl)ethanamine.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-1-(thiadiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 105137300 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-1-(thiadiazol-4-yl)ethanamine |
| SMILES | COc1ccc(Cl)cc1CC(N)c1csnn1 |
| InChI | InChI=1S/C11H12ClN3OS/c1-16-11-3-2-8(12)4-7(11)5-9(13)10-6-17-15-14-10/h2-4,6,9H,5,13H2,1H3 |
| InChIKey | DGQBJSQWZZTCNP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |