C16H23N3S — CID 105136962
2-(4-propan-2-ylphenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine (PubChem CID 105136962) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 2-(4-propan-2-ylphenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine.
| Compound Name | 2-(4-propan-2-ylphenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 105136962 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-(4-propan-2-ylphenyl)-1-(4-propan-2-ylthiadiazol-5-yl)ethanamine |
| SMILES | CC(C)c1ccc(CC(N)c2snnc2C(C)C)cc1 |
| InChI | InChI=1S/C16H23N3S/c1-10(2)13-7-5-12(6-8-13)9-14(17)16-15(11(3)4)18-19-20-16/h5-8,10-11,14H,9,17H2,1-4H3 |
| InChIKey | CBCHQUTUWSSTNX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |