C11H14N2OS2 — CID 105087181
1-(4-propylthiadiazol-5-yl)-2-thiophen-2-ylethanol (PubChem CID 105087181) has the molecular formula C11H14N2OS2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 1-(4-propylthiadiazol-5-yl)-2-thiophen-2-ylethanol.
| Compound Name | 1-(4-propylthiadiazol-5-yl)-2-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 105087181 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 1-(4-propylthiadiazol-5-yl)-2-thiophen-2-ylethanol |
| SMILES | CCCc1nnsc1C(O)Cc1cccs1 |
| InChI | InChI=1S/C11H14N2OS2/c1-2-4-9-11(16-13-12-9)10(14)7-8-5-3-6-15-8/h3,5-6,10,14H,2,4,7H2,1H3 |
| InChIKey | LPBWLYGQLKKHRF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |