C15H25NO3 — CID 105088777
5-methoxy-1-(4-methoxy-3,5-dimethyl-2-pyridinyl)hexan-2-ol (PubChem CID 105088777) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 5-methoxy-1-(4-methoxy-3,5-dimethyl-2-pyridinyl)hexan-2-ol.
| Compound Name | 5-methoxy-1-(4-methoxy-3,5-dimethyl-2-pyridinyl)hexan-2-ol |
|---|---|
| PubChem CID | 105088777 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 5-methoxy-1-(4-methoxy-3,5-dimethyl-2-pyridinyl)hexan-2-ol |
| SMILES | COc1c(C)cnc(CC(O)CCC(C)OC)c1C |
| InChI | InChI=1S/C15H25NO3/c1-10-9-16-14(12(3)15(10)19-5)8-13(17)7-6-11(2)18-4/h9,11,13,17H,6-8H2,1-5H3 |
| InChIKey | XEWCCEQYUBFCJM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |