C12H14N2OS — CID 105089473
1-(3,6-dimethylpyridazin-4-yl)-2-thiophen-3-ylethanol (PubChem CID 105089473) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 1-(3,6-dimethylpyridazin-4-yl)-2-thiophen-3-ylethanol.
| Compound Name | 1-(3,6-dimethylpyridazin-4-yl)-2-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 105089473 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 1-(3,6-dimethylpyridazin-4-yl)-2-thiophen-3-ylethanol |
| SMILES | Cc1cc(C(O)Cc2ccsc2)c(C)nn1 |
| InChI | InChI=1S/C12H14N2OS/c1-8-5-11(9(2)14-13-8)12(15)6-10-3-4-16-7-10/h3-5,7,12,15H,6H2,1-2H3 |
| InChIKey | KGWCNUFEEPDYSH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |