C13H12F2OS — CID 113396557
1-(2,4-difluoro-5-methylphenyl)-2-thiophen-3-ylethanol (PubChem CID 113396557) has the molecular formula C13H12F2OS and a molecular weight of 254.30 g/mol. Its IUPAC name is 1-(2,4-difluoro-5-methylphenyl)-2-thiophen-3-ylethanol.
| Compound Name | 1-(2,4-difluoro-5-methylphenyl)-2-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 113396557 |
| Molecular Formula | C13H12F2OS |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 1-(2,4-difluoro-5-methylphenyl)-2-thiophen-3-ylethanol |
| SMILES | Cc1cc(C(O)Cc2ccsc2)c(F)cc1F |
| InChI | InChI=1S/C13H12F2OS/c1-8-4-10(12(15)6-11(8)14)13(16)5-9-2-3-17-7-9/h2-4,6-7,13,16H,5H2,1H3 |
| InChIKey | HWIMASOCBBWWFW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |