C16H12Cl2N2O — CID 105089763
1-(benzimidazol-1-yl)-3-(3,4-dichlorophenyl)propan-2-one (PubChem CID 105089763) has the molecular formula C16H12Cl2N2O and a molecular weight of 319.19 g/mol. Its IUPAC name is 1-(benzimidazol-1-yl)-3-(3,4-dichlorophenyl)propan-2-one.
| Compound Name | 1-(benzimidazol-1-yl)-3-(3,4-dichlorophenyl)propan-2-one |
|---|---|
| PubChem CID | 105089763 |
| Molecular Formula | C16H12Cl2N2O |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 1-(benzimidazol-1-yl)-3-(3,4-dichlorophenyl)propan-2-one |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)Cn1cnc2ccccc21 |
| InChI | InChI=1S/C16H12Cl2N2O/c17-13-6-5-11(8-14(13)18)7-12(21)9-20-10-19-15-3-1-2-4-16(15)20/h1-6,8,10H,7,9H2 |
| InChIKey | XUEQPOHGRWFCCQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |