C10H11BrN2OS2 — CID 105090584
2-(4-bromothiophen-2-yl)-1-(4-ethylthiadiazol-5-yl)ethanol (PubChem CID 105090584) has the molecular formula C10H11BrN2OS2 and a molecular weight of 319.25 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-(4-ethylthiadiazol-5-yl)ethanol.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-(4-ethylthiadiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 105090584 |
| Molecular Formula | C10H11BrN2OS2 |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 317.95 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-(4-ethylthiadiazol-5-yl)ethanol |
| SMILES | CCc1nnsc1C(O)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C10H11BrN2OS2/c1-2-8-10(16-13-12-8)9(14)4-7-3-6(11)5-15-7/h3,5,9,14H,2,4H2,1H3 |
| InChIKey | MFOISBLYTDMKSW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |