C12H15BrN2OS2 — CID 105090608
2-(4-bromothiophen-2-yl)-1-(4-tert-butylthiadiazol-5-yl)ethanol (PubChem CID 105090608) has the molecular formula C12H15BrN2OS2 and a molecular weight of 347.30 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-(4-tert-butylthiadiazol-5-yl)ethanol.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-(4-tert-butylthiadiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 105090608 |
| Molecular Formula | C12H15BrN2OS2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-(4-tert-butylthiadiazol-5-yl)ethanol |
| SMILES | CC(C)(C)c1nnsc1C(O)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C12H15BrN2OS2/c1-12(2,3)11-10(18-15-14-11)9(16)5-8-4-7(13)6-17-8/h4,6,9,16H,5H2,1-3H3 |
| InChIKey | MIOMZLARVSJFEO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |