C9H6F2N2OS — CID 105094780
(2,5-difluorophenyl)-(1,2,5-thiadiazol-3-yl)methanol (PubChem CID 105094780) has the molecular formula C9H6F2N2OS and a molecular weight of 228.22 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(1,2,5-thiadiazol-3-yl)methanol.
| Compound Name | (2,5-difluorophenyl)-(1,2,5-thiadiazol-3-yl)methanol |
|---|---|
| PubChem CID | 105094780 |
| Molecular Formula | C9H6F2N2OS |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | (2,5-difluorophenyl)-(1,2,5-thiadiazol-3-yl)methanol |
| SMILES | OC(c1cnsn1)c1cc(F)ccc1F |
| InChI | InChI=1S/C9H6F2N2OS/c10-5-1-2-7(11)6(3-5)9(14)8-4-12-15-13-8/h1-4,9,14H |
| InChIKey | KQHHYYXDGSXPQW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |