C10H8F2N2OS — CID 105094790
(2,5-difluorophenyl)-(4-methylthiadiazol-5-yl)methanol (PubChem CID 105094790) has the molecular formula C10H8F2N2OS and a molecular weight of 242.25 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(4-methylthiadiazol-5-yl)methanol.
| Compound Name | (2,5-difluorophenyl)-(4-methylthiadiazol-5-yl)methanol |
|---|---|
| PubChem CID | 105094790 |
| Molecular Formula | C10H8F2N2OS |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | (2,5-difluorophenyl)-(4-methylthiadiazol-5-yl)methanol |
| SMILES | Cc1nnsc1C(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C10H8F2N2OS/c1-5-10(16-14-13-5)9(15)7-4-6(11)2-3-8(7)12/h2-4,9,15H,1H3 |
| InChIKey | AQOYPOHHJNERHI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |