C13H10F2O2 — CID 105095139
1-(3,5-difluorophenyl)-3-(furan-2-yl)propan-1-one (PubChem CID 105095139) has the molecular formula C13H10F2O2 and a molecular weight of 236.22 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-(furan-2-yl)propan-1-one.
| Compound Name | 1-(3,5-difluorophenyl)-3-(furan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 105095139 |
| Molecular Formula | C13H10F2O2 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-(furan-2-yl)propan-1-one |
| SMILES | O=C(CCc1ccco1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H10F2O2/c14-10-6-9(7-11(15)8-10)13(16)4-3-12-2-1-5-17-12/h1-2,5-8H,3-4H2 |
| InChIKey | KMQHFNZHWFAYEQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |