C14H12F2O2 — CID 105124464
1-(2,6-difluoro-3-methylphenyl)-3-(furan-2-yl)propan-1-one (PubChem CID 105124464) has the molecular formula C14H12F2O2 and a molecular weight of 250.24 g/mol. Its IUPAC name is 1-(2,6-difluoro-3-methylphenyl)-3-(furan-2-yl)propan-1-one.
| Compound Name | 1-(2,6-difluoro-3-methylphenyl)-3-(furan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 105124464 |
| Molecular Formula | C14H12F2O2 |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 1-(2,6-difluoro-3-methylphenyl)-3-(furan-2-yl)propan-1-one |
| SMILES | Cc1ccc(F)c(C(=O)CCc2ccco2)c1F |
| InChI | InChI=1S/C14H12F2O2/c1-9-4-6-11(15)13(14(9)16)12(17)7-5-10-3-2-8-18-10/h2-4,6,8H,5,7H2,1H3 |
| InChIKey | LCCRQMMNSHJRQX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |