C19H24O2 — CID 105095182
3-(3-methylphenyl)-1-(4-propoxyphenyl)propan-1-ol (PubChem CID 105095182) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 3-(3-methylphenyl)-1-(4-propoxyphenyl)propan-1-ol.
| Compound Name | 3-(3-methylphenyl)-1-(4-propoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 105095182 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 3-(3-methylphenyl)-1-(4-propoxyphenyl)propan-1-ol |
| SMILES | CCCOc1ccc(C(O)CCc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C19H24O2/c1-3-13-21-18-10-8-17(9-11-18)19(20)12-7-16-6-4-5-15(2)14-16/h4-6,8-11,14,19-20H,3,7,12-13H2,1-2H3 |
| InChIKey | UDVYUXYXANRGGG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |