C12H6ClF2NO — CID 105095200
(3-chloro-4-pyridinyl)-(3,5-difluorophenyl)methanone (PubChem CID 105095200) has the molecular formula C12H6ClF2NO and a molecular weight of 253.64 g/mol. Its IUPAC name is (3-chloro-4-pyridinyl)-(3,5-difluorophenyl)methanone.
| Compound Name | (3-chloro-4-pyridinyl)-(3,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 105095200 |
| Molecular Formula | C12H6ClF2NO |
| Molecular Weight | 253.64 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | (3-chloro-4-pyridinyl)-(3,5-difluorophenyl)methanone |
| SMILES | O=C(c1cc(F)cc(F)c1)c1ccncc1Cl |
| InChI | InChI=1S/C12H6ClF2NO/c13-11-6-16-2-1-10(11)12(17)7-3-8(14)5-9(15)4-7/h1-6H |
| InChIKey | SBELGXVAWAFYQW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |