C14H16F2N2O — CID 105096371
(1,3-diethylpyrazol-5-yl)-(3,4-difluorophenyl)methanol (PubChem CID 105096371) has the molecular formula C14H16F2N2O and a molecular weight of 266.29 g/mol. Its IUPAC name is (1,3-diethylpyrazol-5-yl)-(3,4-difluorophenyl)methanol.
| Compound Name | (1,3-diethylpyrazol-5-yl)-(3,4-difluorophenyl)methanol |
|---|---|
| PubChem CID | 105096371 |
| Molecular Formula | C14H16F2N2O |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (1,3-diethylpyrazol-5-yl)-(3,4-difluorophenyl)methanol |
| SMILES | CCc1cc(C(O)c2ccc(F)c(F)c2)n(CC)n1 |
| InChI | InChI=1S/C14H16F2N2O/c1-3-10-8-13(18(4-2)17-10)14(19)9-5-6-11(15)12(16)7-9/h5-8,14,19H,3-4H2,1-2H3 |
| InChIKey | KOPXCJLAXCSMHP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |