C18H24N2O — CID 105132344
(3-cyclobutylphenyl)-(1,3-diethylpyrazol-5-yl)methanol (PubChem CID 105132344) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is (3-cyclobutylphenyl)-(1,3-diethylpyrazol-5-yl)methanol.
| Compound Name | (3-cyclobutylphenyl)-(1,3-diethylpyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 105132344 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (3-cyclobutylphenyl)-(1,3-diethylpyrazol-5-yl)methanol |
| SMILES | CCc1cc(C(O)c2cccc(C3CCC3)c2)n(CC)n1 |
| InChI | InChI=1S/C18H24N2O/c1-3-16-12-17(20(4-2)19-16)18(21)15-10-6-9-14(11-15)13-7-5-8-13/h6,9-13,18,21H,3-5,7-8H2,1-2H3 |
| InChIKey | AAMJXDWCUXMWLH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |