C18H19FO — CID 114602208
(3-cyclobutylphenyl)-(5-fluoro-2-methylphenyl)methanol (PubChem CID 114602208) has the molecular formula C18H19FO and a molecular weight of 270.35 g/mol. Its IUPAC name is (3-cyclobutylphenyl)-(5-fluoro-2-methylphenyl)methanol.
| Compound Name | (3-cyclobutylphenyl)-(5-fluoro-2-methylphenyl)methanol |
|---|---|
| PubChem CID | 114602208 |
| Molecular Formula | C18H19FO |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (3-cyclobutylphenyl)-(5-fluoro-2-methylphenyl)methanol |
| SMILES | Cc1ccc(F)cc1C(O)c1cccc(C2CCC2)c1 |
| InChI | InChI=1S/C18H19FO/c1-12-8-9-16(19)11-17(12)18(20)15-7-3-6-14(10-15)13-4-2-5-13/h3,6-11,13,18,20H,2,4-5H2,1H3 |
| InChIKey | XPGXWQOVKBPNPK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |