C17H17FO — CID 107128110
(3-cyclopropylphenyl)-(3-fluoro-4-methylphenyl)methanol (PubChem CID 107128110) has the molecular formula C17H17FO and a molecular weight of 256.32 g/mol. Its IUPAC name is (3-cyclopropylphenyl)-(3-fluoro-4-methylphenyl)methanol.
| Compound Name | (3-cyclopropylphenyl)-(3-fluoro-4-methylphenyl)methanol |
|---|---|
| PubChem CID | 107128110 |
| Molecular Formula | C17H17FO |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (3-cyclopropylphenyl)-(3-fluoro-4-methylphenyl)methanol |
| SMILES | Cc1ccc(C(O)c2cccc(C3CC3)c2)cc1F |
| InChI | InChI=1S/C17H17FO/c1-11-5-6-15(10-16(11)18)17(19)14-4-2-3-13(9-14)12-7-8-12/h2-6,9-10,12,17,19H,7-8H2,1H3 |
| InChIKey | NQHJOTYWXIUPCA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |