C16H14Cl2O — CID 79980407
(3-cyclopropylphenyl)-(3,4-dichlorophenyl)methanol (PubChem CID 79980407) has the molecular formula C16H14Cl2O and a molecular weight of 293.19 g/mol. Its IUPAC name is (3-cyclopropylphenyl)-(3,4-dichlorophenyl)methanol.
| Compound Name | (3-cyclopropylphenyl)-(3,4-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 79980407 |
| Molecular Formula | C16H14Cl2O |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | (3-cyclopropylphenyl)-(3,4-dichlorophenyl)methanol |
| SMILES | OC(c1cccc(C2CC2)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2O/c17-14-7-6-13(9-15(14)18)16(19)12-3-1-2-11(8-12)10-4-5-10/h1-3,6-10,16,19H,4-5H2 |
| InChIKey | GWXVIXKTHGZOQA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |