C14H14N2S — CID 105098031
2,3-dihydro-1-benzothiophen-2-yl(pyridin-3-yl)methanamine (PubChem CID 105098031) has the molecular formula C14H14N2S and a molecular weight of 242.35 g/mol. Its IUPAC name is 2,3-dihydro-1-benzothiophen-2-yl(pyridin-3-yl)methanamine.
| Compound Name | 2,3-dihydro-1-benzothiophen-2-yl(pyridin-3-yl)methanamine |
|---|---|
| PubChem CID | 105098031 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2,3-dihydro-1-benzothiophen-2-yl(pyridin-3-yl)methanamine |
| SMILES | NC(c1cccnc1)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C14H14N2S/c15-14(11-5-3-7-16-9-11)13-8-10-4-1-2-6-12(10)17-13/h1-7,9,13-14H,8,15H2 |
| InChIKey | QZQLQDCWVAPPTP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |