C18H21NS — CID 105144289
2,3-dihydro-1-benzothiophen-2-yl-(4-propylphenyl)methanamine (PubChem CID 105144289) has the molecular formula C18H21NS and a molecular weight of 283.44 g/mol. Its IUPAC name is 2,3-dihydro-1-benzothiophen-2-yl-(4-propylphenyl)methanamine.
| Compound Name | 2,3-dihydro-1-benzothiophen-2-yl-(4-propylphenyl)methanamine |
|---|---|
| PubChem CID | 105144289 |
| Molecular Formula | C18H21NS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2,3-dihydro-1-benzothiophen-2-yl-(4-propylphenyl)methanamine |
| SMILES | CCCc1ccc(C(N)C2Cc3ccccc3S2)cc1 |
| InChI | InChI=1S/C18H21NS/c1-2-5-13-8-10-14(11-9-13)18(19)17-12-15-6-3-4-7-16(15)20-17/h3-4,6-11,17-18H,2,5,12,19H2,1H3 |
| InChIKey | RNZFIDOVXMJPLD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |