C17H33F2N — CID 105102951
1-(4,4-difluorocyclohexyl)-N,3-diethylheptan-1-amine (PubChem CID 105102951) has the molecular formula C17H33F2N and a molecular weight of 289.45 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-N,3-diethylheptan-1-amine.
| Compound Name | 1-(4,4-difluorocyclohexyl)-N,3-diethylheptan-1-amine |
|---|---|
| PubChem CID | 105102951 |
| Molecular Formula | C17H33F2N |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-N,3-diethylheptan-1-amine |
| SMILES | CCCCC(CC)CC(NCC)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C17H33F2N/c1-4-7-8-14(5-2)13-16(20-6-3)15-9-11-17(18,19)12-10-15/h14-16,20H,4-13H2,1-3H3 |
| InChIKey | GQXVNZUROWHHCQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |