C14H25F2N — CID 105153076
1-(4,4-difluorocyclohexyl)-N-ethylhex-5-en-1-amine (PubChem CID 105153076) has the molecular formula C14H25F2N and a molecular weight of 245.36 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-N-ethylhex-5-en-1-amine.
| Compound Name | 1-(4,4-difluorocyclohexyl)-N-ethylhex-5-en-1-amine |
|---|---|
| PubChem CID | 105153076 |
| Molecular Formula | C14H25F2N |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-N-ethylhex-5-en-1-amine |
| SMILES | C=CCCCC(NCC)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H25F2N/c1-3-5-6-7-13(17-4-2)12-8-10-14(15,16)11-9-12/h3,12-13,17H,1,4-11H2,2H3 |
| InChIKey | NYQXDKSGTDVRLK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|