C15H22N4 — CID 105103926
4-[amino-(1-propylpyrazol-4-yl)methyl]-N,N-dimethylaniline (PubChem CID 105103926) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 4-[amino-(1-propylpyrazol-4-yl)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[amino-(1-propylpyrazol-4-yl)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 105103926 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 4-[amino-(1-propylpyrazol-4-yl)methyl]-N,N-dimethylaniline |
| SMILES | CCCn1cc(C(N)c2ccc(N(C)C)cc2)cn1 |
| InChI | InChI=1S/C15H22N4/c1-4-9-19-11-13(10-17-19)15(16)12-5-7-14(8-6-12)18(2)3/h5-8,10-11,15H,4,9,16H2,1-3H3 |
| InChIKey | ZFHRGAXPCWFPKG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |