C13H15Cl2N3 — CID 115807774
(2,5-dichlorophenyl)-(1-propylpyrazol-4-yl)methanamine (PubChem CID 115807774) has the molecular formula C13H15Cl2N3 and a molecular weight of 284.19 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(1-propylpyrazol-4-yl)methanamine.
| Compound Name | (2,5-dichlorophenyl)-(1-propylpyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 115807774 |
| Molecular Formula | C13H15Cl2N3 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | (2,5-dichlorophenyl)-(1-propylpyrazol-4-yl)methanamine |
| SMILES | CCCn1cc(C(N)c2cc(Cl)ccc2Cl)cn1 |
| InChI | InChI=1S/C13H15Cl2N3/c1-2-5-18-8-9(7-17-18)13(16)11-6-10(14)3-4-12(11)15/h3-4,6-8,13H,2,5,16H2,1H3 |
| InChIKey | JYBFLLNIYIITLT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |