C15H19Cl2N3 — CID 115807598
N-[(2,5-dichlorophenyl)-(1-propylpyrazol-4-yl)methyl]ethanamine (PubChem CID 115807598) has the molecular formula C15H19Cl2N3 and a molecular weight of 312.24 g/mol. Its IUPAC name is N-[(2,5-dichlorophenyl)-(1-propylpyrazol-4-yl)methyl]ethanamine.
| Compound Name | N-[(2,5-dichlorophenyl)-(1-propylpyrazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 115807598 |
| Molecular Formula | C15H19Cl2N3 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-[(2,5-dichlorophenyl)-(1-propylpyrazol-4-yl)methyl]ethanamine |
| SMILES | CCCn1cc(C(NCC)c2cc(Cl)ccc2Cl)cn1 |
| InChI | InChI=1S/C15H19Cl2N3/c1-3-7-20-10-11(9-19-20)15(18-4-2)13-8-12(16)5-6-14(13)17/h5-6,8-10,15,18H,3-4,7H2,1-2H3 |
| InChIKey | HXMQTDUMQPLHFL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |